About N-[(E)-but-2-en-2-yl]-N,N'-dimethylmethanimidamide
N-[(E)-but-2-en-2-yl]-N,N'-dimethylmethanimidamide (PubChem CID 130311603) has the molecular formula C7H14N2
and a molecular weight of 126.20 g/mol. Its IUPAC name is N-[(E)-but-2-en-2-yl]-N,N'-dimethylmethanimidamide.
Molecular Properties
| Compound Name | N-[(E)-but-2-en-2-yl]-N,N'-dimethylmethanimidamide |
| PubChem CID | 130311603 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | N-[(E)-but-2-en-2-yl]-N,N'-dimethylmethanimidamide |
| SMILES | C/C=C(\C)N(C)/C=N/C |
| InChI | InChI=1S/C7H14N2/c1-5-7(2)9(4)6-8-3/h5-6H,1-4H3/b7-5+,8-6+ |
| InChIKey | JKLPJFAMDUCNCF-KQQUZDAGSA-N |
| XLogP | 1.50 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-but-2-en-2-yl]-N,N'-dimethylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-but-2-en-2-yl]-N,N'-dimethylmethanimidamide?
The IUPAC name of N-[(E)-but-2-en-2-yl]-N,N'-dimethylmethanimidamide (CID 130311603) is N-[(E)-but-2-en-2-yl]-N,N'-dimethylmethanimidamide.
What is the SMILES notation for N-[(E)-but-2-en-2-yl]-N,N'-dimethylmethanimidamide?
The canonical SMILES for N-[(E)-but-2-en-2-yl]-N,N'-dimethylmethanimidamide is C/C=C(\C)N(C)/C=N/C.
What is the InChIKey of N-[(E)-but-2-en-2-yl]-N,N'-dimethylmethanimidamide?
The InChIKey is JKLPJFAMDUCNCF-KQQUZDAGSA-N. The full InChI is InChI=1S/C7H14N2/c1-5-7(2)9(4)6-8-3/h5-6H,1-4H3/b7-5+,8-6+.
What are the key properties of N-[(E)-but-2-en-2-yl]-N,N'-dimethylmethanimidamide?
N-[(E)-but-2-en-2-yl]-N,N'-dimethylmethanimidamide has a molecular weight of 126.20 g/mol, XLogP of 1.50, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-but-2-en-2-yl]-N,N'-dimethylmethanimidamide is sourced from PubChem (CID 130311603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).