C10H8F3N3O3S — CID 130311843
(7-cyclopropylpyrrolo[2,1-f][1,2,4]triazin-2-yl) trifluoromethanesulfonate (PubChem CID 130311843) has the molecular formula C10H8F3N3O3S and a molecular weight of 307.25 g/mol. Its IUPAC name is (7-cyclopropylpyrrolo[2,1-f][1,2,4]triazin-2-yl) trifluoromethanesulfonate.
| Compound Name | (7-cyclopropylpyrrolo[2,1-f][1,2,4]triazin-2-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 130311843 |
| Molecular Formula | C10H8F3N3O3S |
| Molecular Weight | 307.25 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | (7-cyclopropylpyrrolo[2,1-f][1,2,4]triazin-2-yl) trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ncc2ccc(C3CC3)n2n1)C(F)(F)F |
| InChI | InChI=1S/C10H8F3N3O3S/c11-10(12,13)20(17,18)19-9-14-5-7-3-4-8(6-1-2-6)16(7)15-9/h3-6H,1-2H2 |
| InChIKey | JGXIKLRKHVINAP-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 73.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.25 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|