C8H6F3N3O3S — CID 130311900
(7-methylpyrrolo[2,1-f][1,2,4]triazin-2-yl) trifluoromethanesulfonate (PubChem CID 130311900) has the molecular formula C8H6F3N3O3S and a molecular weight of 281.22 g/mol. Its IUPAC name is (7-methylpyrrolo[2,1-f][1,2,4]triazin-2-yl) trifluoromethanesulfonate.
| Compound Name | (7-methylpyrrolo[2,1-f][1,2,4]triazin-2-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 130311900 |
| Molecular Formula | C8H6F3N3O3S |
| Molecular Weight | 281.22 g/mol |
| Exact Mass | 281.01 |
| IUPAC Name | (7-methylpyrrolo[2,1-f][1,2,4]triazin-2-yl) trifluoromethanesulfonate |
| SMILES | Cc1ccc2cnc(OS(=O)(=O)C(F)(F)F)nn12 |
| InChI | InChI=1S/C8H6F3N3O3S/c1-5-2-3-6-4-12-7(13-14(5)6)17-18(15,16)8(9,10)11/h2-4H,1H3 |
| InChIKey | MZCHFRNDYQDOTH-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 73.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.22 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|