C35H50O5S2 — CID 130311977
5-methyl-2-propan-2-yl-4-[(2,4,6-tricyclohexylphenyl)sulfonylmethyl]benzenesulfonic acid (PubChem CID 130311977) has the molecular formula C35H50O5S2 and a molecular weight of 614.91 g/mol. Its IUPAC name is 5-methyl-2-propan-2-yl-4-[(2,4,6-tricyclohexylphenyl)sulfonylmethyl]benzenesulfonic acid.
| Compound Name | 5-methyl-2-propan-2-yl-4-[(2,4,6-tricyclohexylphenyl)sulfonylmethyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 130311977 |
| Molecular Formula | C35H50O5S2 |
| Molecular Weight | 614.91 g/mol |
| Exact Mass | 614.31 |
| IUPAC Name | 5-methyl-2-propan-2-yl-4-[(2,4,6-tricyclohexylphenyl)sulfonylmethyl]benzenesulfonic acid |
| SMILES | Cc1cc(S(=O)(=O)O)c(C(C)C)cc1CS(=O)(=O)c1c(C2CCCCC2)cc(C2CCCCC2)cc1C1CCCCC1 |
| InChI | InChI=1S/C35H50O5S2/c1-24(2)31-22-30(25(3)19-34(31)42(38,39)40)23-41(36,37)35-32(27-15-9-5-10-16-27)20-29(26-13-7-4-8-14-26)21-33(35)28-17-11-6-12-18-28/h19-22,24,26-28H,4-18,23H2,1-3H3,(H,38,39,40) |
| InChIKey | RDXQJFUADBJDQG-UHFFFAOYSA-N |
| XLogP | 9.48 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.91 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|