C27H31N5O5 — CID 130312193
3-[7-[[4-[(4-acetylpiperazin-1-yl)methyl]phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]-1-aminopiperidine-2,6-dione (PubChem CID 130312193) has the molecular formula C27H31N5O5 and a molecular weight of 505.58 g/mol. Its IUPAC name is 3-[7-[[4-[(4-acetylpiperazin-1-yl)methyl]phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]-1-aminopiperidine-2,6-dione.
| Compound Name | 3-[7-[[4-[(4-acetylpiperazin-1-yl)methyl]phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]-1-aminopiperidine-2,6-dione |
|---|---|
| PubChem CID | 130312193 |
| Molecular Formula | C27H31N5O5 |
| Molecular Weight | 505.58 g/mol |
| Exact Mass | 505.23 |
| IUPAC Name | 3-[7-[[4-[(4-acetylpiperazin-1-yl)methyl]phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]-1-aminopiperidine-2,6-dione |
| SMILES | CC(=O)N1CCN(Cc2ccc(COc3cccc4c3CN(C3CCC(=O)N(N)C3=O)C4=O)cc2)CC1 |
| InChI | InChI=1S/C27H31N5O5/c1-18(33)30-13-11-29(12-14-30)15-19-5-7-20(8-6-19)17-37-24-4-2-3-21-22(24)16-31(26(21)35)23-9-10-25(34)32(28)27(23)36/h2-8,23H,9-17,28H2,1H3 |
| InChIKey | MLRPUZFXBHPMNV-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 116.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.58 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|