C34H56O2 — CID 130312401
11-(buta-1,3-dien-2-yloxymethyl)-14-methylidene-7-(3-methylidenepent-4-enyl)-7,11-dipropylhexadec-1-en-3-one (PubChem CID 130312401) has the molecular formula C34H56O2 and a molecular weight of 496.82 g/mol. Its IUPAC name is 11-(buta-1,3-dien-2-yloxymethyl)-14-methylidene-7-(3-methylidenepent-4-enyl)-7,11-dipropylhexadec-1-en-3-one.
| Compound Name | 11-(buta-1,3-dien-2-yloxymethyl)-14-methylidene-7-(3-methylidenepent-4-enyl)-7,11-dipropylhexadec-1-en-3-one |
|---|---|
| PubChem CID | 130312401 |
| Molecular Formula | C34H56O2 |
| Molecular Weight | 496.82 g/mol |
| Exact Mass | 496.43 |
| IUPAC Name | 11-(buta-1,3-dien-2-yloxymethyl)-14-methylidene-7-(3-methylidenepent-4-enyl)-7,11-dipropylhexadec-1-en-3-one |
| SMILES | C=CC(=C)CCC(CCC)(CCCC(=O)C=C)CCCC(CCC)(CCC(=C)CC)COC(=C)C=C |
| InChI | InChI=1S/C34H56O2/c1-10-21-33(26-19-29(7)12-3,23-16-18-32(35)15-6)24-17-25-34(22-11-2,27-20-30(8)13-4)28-36-31(9)14-5/h12,14-15H,3,5-11,13,16-28H2,1-2,4H3 |
| InChIKey | SDJIGWJAHUBYCR-UHFFFAOYSA-N |
| XLogP | 10.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.82 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|