C16H29NO — CID 130312631
1-[(E)-6,6-dimethylhept-3-en-4-yl]-4,4-dimethylpyrrolidine-2-carbaldehyde (PubChem CID 130312631) has the molecular formula C16H29NO and a molecular weight of 251.41 g/mol. Its IUPAC name is 1-[(E)-6,6-dimethylhept-3-en-4-yl]-4,4-dimethylpyrrolidine-2-carbaldehyde.
| Compound Name | 1-[(E)-6,6-dimethylhept-3-en-4-yl]-4,4-dimethylpyrrolidine-2-carbaldehyde |
|---|---|
| PubChem CID | 130312631 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | 1-[(E)-6,6-dimethylhept-3-en-4-yl]-4,4-dimethylpyrrolidine-2-carbaldehyde |
| SMILES | CC/C=C(\CC(C)(C)C)N1CC(C)(C)CC1C=O |
| InChI | InChI=1S/C16H29NO/c1-7-8-13(9-15(2,3)4)17-12-16(5,6)10-14(17)11-18/h8,11,14H,7,9-10,12H2,1-6H3/b13-8+ |
| InChIKey | BDIHYAYONHDXAI-MDWZMJQESA-N |
| XLogP | 4.02 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|