C6Cl3F3 — CID 13031264
1,2,4-trichloro-3,5,6-trifluorobenzene (PubChem CID 13031264) has the molecular formula C6Cl3F3 and a molecular weight of 235.42 g/mol. Its IUPAC name is 1,2,4-trichloro-3,5,6-trifluorobenzene.
| Compound Name | 1,2,4-trichloro-3,5,6-trifluorobenzene |
|---|---|
| PubChem CID | 13031264 |
| Molecular Formula | C6Cl3F3 |
| Molecular Weight | 235.42 g/mol |
| Exact Mass | 233.90 |
| IUPAC Name | 1,2,4-trichloro-3,5,6-trifluorobenzene |
| SMILES | Fc1c(F)c(Cl)c(Cl)c(F)c1Cl |
| InChI | InChI=1S/C6Cl3F3/c7-1-2(8)5(11)6(12)3(9)4(1)10 |
| InChIKey | BZSJKSFTYRTRBL-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.42 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|