C4Cl6F2 — CID 13031273
2,3,3,4,4,4-hexachloro-1,1-difluorobut-1-ene (PubChem CID 13031273) has the molecular formula C4Cl6F2 and a molecular weight of 298.76 g/mol. Its IUPAC name is 2,3,3,4,4,4-hexachloro-1,1-difluorobut-1-ene.
| Compound Name | 2,3,3,4,4,4-hexachloro-1,1-difluorobut-1-ene |
|---|---|
| PubChem CID | 13031273 |
| Molecular Formula | C4Cl6F2 |
| Molecular Weight | 298.76 g/mol |
| Exact Mass | 295.81 |
| IUPAC Name | 2,3,3,4,4,4-hexachloro-1,1-difluorobut-1-ene |
| SMILES | FC(F)=C(Cl)C(Cl)(Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C4Cl6F2/c5-1(2(11)12)3(6,7)4(8,9)10 |
| InChIKey | SWVXYDDFKBZQON-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.76 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|