C16H17N3 — CID 130312830
2,4-di(cyclohexa-2,4-dien-1-yl)-6-methyl-1,3,5-triazine (PubChem CID 130312830) has the molecular formula C16H17N3 and a molecular weight of 251.33 g/mol. Its IUPAC name is 2,4-di(cyclohexa-2,4-dien-1-yl)-6-methyl-1,3,5-triazine.
| Compound Name | 2,4-di(cyclohexa-2,4-dien-1-yl)-6-methyl-1,3,5-triazine |
|---|---|
| PubChem CID | 130312830 |
| Molecular Formula | C16H17N3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 2,4-di(cyclohexa-2,4-dien-1-yl)-6-methyl-1,3,5-triazine |
| SMILES | Cc1nc(C2C=CC=CC2)nc(C2C=CC=CC2)n1 |
| InChI | InChI=1S/C16H17N3/c1-12-17-15(13-8-4-2-5-9-13)19-16(18-12)14-10-6-3-7-11-14/h2-8,10,13-14H,9,11H2,1H3 |
| InChIKey | TYXDGTDYOZCEHZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |