C31H30N4O4 — CID 130313023
N-[2-[2-(4-hydroxyphenyl)ethoxy]-4-[hydroxy-(2-pyridin-4-ylethylamino)methyl]phenyl]-1H-indole-2-carboxamide (PubChem CID 130313023) has the molecular formula C31H30N4O4 and a molecular weight of 522.61 g/mol. Its IUPAC name is N-[2-[2-(4-hydroxyphenyl)ethoxy]-4-[hydroxy-(2-pyridin-4-ylethylamino)methyl]phenyl]-1H-indole-2-carboxamide.
| Compound Name | N-[2-[2-(4-hydroxyphenyl)ethoxy]-4-[hydroxy-(2-pyridin-4-ylethylamino)methyl]phenyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 130313023 |
| Molecular Formula | C31H30N4O4 |
| Molecular Weight | 522.61 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | N-[2-[2-(4-hydroxyphenyl)ethoxy]-4-[hydroxy-(2-pyridin-4-ylethylamino)methyl]phenyl]-1H-indole-2-carboxamide |
| SMILES | O=C(Nc1ccc(C(O)NCCc2ccncc2)cc1OCCc1ccc(O)cc1)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C31H30N4O4/c36-25-8-5-21(6-9-25)14-18-39-29-20-24(30(37)33-17-13-22-11-15-32-16-12-22)7-10-27(29)35-31(38)28-19-23-3-1-2-4-26(23)34-28/h1-12,15-16,19-20,30,33-34,36-37H,13-14,17-18H2,(H,35,38) |
| InChIKey | VWPWEHRZCWCQJV-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 119.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.61 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|