C17H22ClN5O2 — CID 130313155
N-[(2-amino-6-chlorophenyl)methyl]-N-[2-(3-hydroxypyrrolidin-1-yl)ethyl]-1H-pyrazole-5-carboxamide (PubChem CID 130313155) has the molecular formula C17H22ClN5O2 and a molecular weight of 363.85 g/mol. Its IUPAC name is N-[(2-amino-6-chlorophenyl)methyl]-N-[2-(3-hydroxypyrrolidin-1-yl)ethyl]-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(2-amino-6-chlorophenyl)methyl]-N-[2-(3-hydroxypyrrolidin-1-yl)ethyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 130313155 |
| Molecular Formula | C17H22ClN5O2 |
| Molecular Weight | 363.85 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | N-[(2-amino-6-chlorophenyl)methyl]-N-[2-(3-hydroxypyrrolidin-1-yl)ethyl]-1H-pyrazole-5-carboxamide |
| SMILES | Nc1cccc(Cl)c1CN(CCN1CCC(O)C1)C(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C17H22ClN5O2/c18-14-2-1-3-15(19)13(14)11-23(17(25)16-4-6-20-21-16)9-8-22-7-5-12(24)10-22/h1-4,6,12,24H,5,7-11,19H2,(H,20,21) |
| InChIKey | QGGSUIMYGTUZSV-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.85 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|