About 5-fluoro-2-imino-N,N-dimethylpyridine-1-carboximidamide
5-fluoro-2-imino-N,N-dimethylpyridine-1-carboximidamide (PubChem CID 130313392) has the molecular formula C8H11FN4
and a molecular weight of 182.20 g/mol. Its IUPAC name is 5-fluoro-2-imino-N,N-dimethylpyridine-1-carboximidamide.
Molecular Properties
| Compound Name | 5-fluoro-2-imino-N,N-dimethylpyridine-1-carboximidamide |
| PubChem CID | 130313392 |
| Molecular Formula | C8H11FN4 |
| Molecular Weight | 182.20 g/mol |
| Exact Mass | 182.10 |
| IUPAC Name | 5-fluoro-2-imino-N,N-dimethylpyridine-1-carboximidamide |
| SMILES | [H]/N=C(\N(C)C)n1cc(F)cc/c1=N\[H] |
| InChI | InChI=1S/C8H11FN4/c1-12(2)8(11)13-5-6(9)3-4-7(13)10/h3-5,10-11H,1-2H3/b10-7+,11-8+ |
| InChIKey | GEOHGBIUPXWGBN-AMMQDNIMSA-N |
| XLogP | 0.45 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.20 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-2-imino-N,N-dimethylpyridine-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2-imino-N,N-dimethylpyridine-1-carboximidamide?
The IUPAC name of 5-fluoro-2-imino-N,N-dimethylpyridine-1-carboximidamide (CID 130313392) is 5-fluoro-2-imino-N,N-dimethylpyridine-1-carboximidamide.
What is the SMILES notation for 5-fluoro-2-imino-N,N-dimethylpyridine-1-carboximidamide?
The canonical SMILES for 5-fluoro-2-imino-N,N-dimethylpyridine-1-carboximidamide is [H]/N=C(\N(C)C)n1cc(F)cc/c1=N\[H].
What is the InChIKey of 5-fluoro-2-imino-N,N-dimethylpyridine-1-carboximidamide?
The InChIKey is GEOHGBIUPXWGBN-AMMQDNIMSA-N. The full InChI is InChI=1S/C8H11FN4/c1-12(2)8(11)13-5-6(9)3-4-7(13)10/h3-5,10-11H,1-2H3/b10-7+,11-8+.
What are the key properties of 5-fluoro-2-imino-N,N-dimethylpyridine-1-carboximidamide?
5-fluoro-2-imino-N,N-dimethylpyridine-1-carboximidamide has a molecular weight of 182.20 g/mol, XLogP of 0.45, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2-imino-N,N-dimethylpyridine-1-carboximidamide is sourced from PubChem (CID 130313392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).