About 3-[(2S,5S)-3-methylidene-5-(4-oxo-4-phosphanylbutyl)oxolan-2-yl]propanal
3-[(2S,5S)-3-methylidene-5-(4-oxo-4-phosphanylbutyl)oxolan-2-yl]propanal (PubChem CID 130313428) has the molecular formula C12H19O3P
and a molecular weight of 242.25 g/mol. Its IUPAC name is 3-[(2S,5S)-3-methylidene-5-(4-oxo-4-phosphanylbutyl)oxolan-2-yl]propanal.
Molecular Properties
| Compound Name | 3-[(2S,5S)-3-methylidene-5-(4-oxo-4-phosphanylbutyl)oxolan-2-yl]propanal |
| PubChem CID | 130313428 |
| Molecular Formula | C12H19O3P |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 3-[(2S,5S)-3-methylidene-5-(4-oxo-4-phosphanylbutyl)oxolan-2-yl]propanal |
| SMILES | C=C1C[C@H](CCCC(=O)P)O[C@H]1CCC=O |
| InChI | InChI=1S/C12H19O3P/c1-9-8-10(4-2-6-12(14)16)15-11(9)5-3-7-13/h7,10-11H,1-6,8,16H2/t10-,11-/m0/s1 |
| InChIKey | YKONXNHTKAEIQZ-QWRGUYRKSA-N |
| XLogP | 2.25 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2S,5S)-3-methylidene-5-(4-oxo-4-phosphanylbutyl)oxolan-2-yl]propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2S,5S)-3-methylidene-5-(4-oxo-4-phosphanylbutyl)oxolan-2-yl]propanal?
The IUPAC name of 3-[(2S,5S)-3-methylidene-5-(4-oxo-4-phosphanylbutyl)oxolan-2-yl]propanal (CID 130313428) is 3-[(2S,5S)-3-methylidene-5-(4-oxo-4-phosphanylbutyl)oxolan-2-yl]propanal.
What is the SMILES notation for 3-[(2S,5S)-3-methylidene-5-(4-oxo-4-phosphanylbutyl)oxolan-2-yl]propanal?
The canonical SMILES for 3-[(2S,5S)-3-methylidene-5-(4-oxo-4-phosphanylbutyl)oxolan-2-yl]propanal is C=C1C[C@H](CCCC(=O)P)O[C@H]1CCC=O.
What is the InChIKey of 3-[(2S,5S)-3-methylidene-5-(4-oxo-4-phosphanylbutyl)oxolan-2-yl]propanal?
The InChIKey is YKONXNHTKAEIQZ-QWRGUYRKSA-N. The full InChI is InChI=1S/C12H19O3P/c1-9-8-10(4-2-6-12(14)16)15-11(9)5-3-7-13/h7,10-11H,1-6,8,16H2/t10-,11-/m0/s1.
What are the key properties of 3-[(2S,5S)-3-methylidene-5-(4-oxo-4-phosphanylbutyl)oxolan-2-yl]propanal?
3-[(2S,5S)-3-methylidene-5-(4-oxo-4-phosphanylbutyl)oxolan-2-yl]propanal has a molecular weight of 242.25 g/mol, XLogP of 2.25, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2S,5S)-3-methylidene-5-(4-oxo-4-phosphanylbutyl)oxolan-2-yl]propanal is sourced from PubChem (CID 130313428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).