C23H22FN5O4S — CID 130313980
1-benzyl-4-fluoro-N-[(2R,4S,5S)-11-methylsulfonyl-6-oxo-7-(trideuteriomethyl)-7,9-diazatricyclo[6.4.0.02,4]dodeca-1(8),9,11-trien-5-yl]pyrazole-3-carboxamide (PubChem CID 130313980) has the molecular formula C23H22FN5O4S and a molecular weight of 486.54 g/mol. Its IUPAC name is 1-benzyl-4-fluoro-N-[(2R,4S,5S)-11-methylsulfonyl-6-oxo-7-(trideuteriomethyl)-7,9-diazatricyclo[6.4.0.02,4]dodeca-1(8),9,11-trien-5-yl]pyrazole-3-carboxamide.
| Compound Name | 1-benzyl-4-fluoro-N-[(2R,4S,5S)-11-methylsulfonyl-6-oxo-7-(trideuteriomethyl)-7,9-diazatricyclo[6.4.0.02,4]dodeca-1(8),9,11-trien-5-yl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 130313980 |
| Molecular Formula | C23H22FN5O4S |
| Molecular Weight | 486.54 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | 1-benzyl-4-fluoro-N-[(2R,4S,5S)-11-methylsulfonyl-6-oxo-7-(trideuteriomethyl)-7,9-diazatricyclo[6.4.0.02,4]dodeca-1(8),9,11-trien-5-yl]pyrazole-3-carboxamide |
| SMILES | [2H]C([2H])([2H])N1C(=O)[C@@H](NC(=O)c2nn(Cc3ccccc3)cc2F)[C@H]2C[C@H]2c2cc(S(C)(=O)=O)cnc21 |
| InChI | InChI=1S/C23H22FN5O4S/c1-28-21-17(8-14(10-25-21)34(2,32)33)15-9-16(15)19(23(28)31)26-22(30)20-18(24)12-29(27-20)11-13-6-4-3-5-7-13/h3-8,10,12,15-16,19H,9,11H2,1-2H3,(H,26,30)/t15-,16+,19+/m1/s1/i1D3 |
| InChIKey | HQMIHAPCXMYNSI-NPYLROAWSA-N |
| XLogP | 1.75 |
| TPSA | 114.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.54 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |