About 5-methyl-8,9-dihydro-7H-pyrazino[2,3-b]azepin-6-one
5-methyl-8,9-dihydro-7H-pyrazino[2,3-b]azepin-6-one (PubChem CID 130314135) has the molecular formula C9H11N3O
and a molecular weight of 177.21 g/mol. Its IUPAC name is 5-methyl-8,9-dihydro-7H-pyrazino[2,3-b]azepin-6-one.
Molecular Properties
| Compound Name | 5-methyl-8,9-dihydro-7H-pyrazino[2,3-b]azepin-6-one |
| PubChem CID | 130314135 |
| Molecular Formula | C9H11N3O |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | 5-methyl-8,9-dihydro-7H-pyrazino[2,3-b]azepin-6-one |
| SMILES | CN1C(=O)CCCc2nccnc21 |
| InChI | InChI=1S/C9H11N3O/c1-12-8(13)4-2-3-7-9(12)11-6-5-10-7/h5-6H,2-4H2,1H3 |
| InChIKey | CEJUWYCBKISBFG-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methyl-8,9-dihydro-7H-pyrazino[2,3-b]azepin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-8,9-dihydro-7H-pyrazino[2,3-b]azepin-6-one?
The IUPAC name of 5-methyl-8,9-dihydro-7H-pyrazino[2,3-b]azepin-6-one (CID 130314135) is 5-methyl-8,9-dihydro-7H-pyrazino[2,3-b]azepin-6-one.
What is the SMILES notation for 5-methyl-8,9-dihydro-7H-pyrazino[2,3-b]azepin-6-one?
The canonical SMILES for 5-methyl-8,9-dihydro-7H-pyrazino[2,3-b]azepin-6-one is CN1C(=O)CCCc2nccnc21.
What is the InChIKey of 5-methyl-8,9-dihydro-7H-pyrazino[2,3-b]azepin-6-one?
The InChIKey is CEJUWYCBKISBFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O/c1-12-8(13)4-2-3-7-9(12)11-6-5-10-7/h5-6H,2-4H2,1H3.
What are the key properties of 5-methyl-8,9-dihydro-7H-pyrazino[2,3-b]azepin-6-one?
5-methyl-8,9-dihydro-7H-pyrazino[2,3-b]azepin-6-one has a molecular weight of 177.21 g/mol, XLogP of 0.78, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-8,9-dihydro-7H-pyrazino[2,3-b]azepin-6-one is sourced from PubChem (CID 130314135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).