C22H19N5O3S — CID 130314192
5-benzyl-4-cyano-N-[(2R,3S)-2,5-dimethyl-4-oxo-2,3-dihydropyrido[3,2-b][1,4]oxazepin-3-yl]-1,3-thiazole-2-carboxamide (PubChem CID 130314192) has the molecular formula C22H19N5O3S and a molecular weight of 433.49 g/mol. Its IUPAC name is 5-benzyl-4-cyano-N-[(2R,3S)-2,5-dimethyl-4-oxo-2,3-dihydropyrido[3,2-b][1,4]oxazepin-3-yl]-1,3-thiazole-2-carboxamide.
| Compound Name | 5-benzyl-4-cyano-N-[(2R,3S)-2,5-dimethyl-4-oxo-2,3-dihydropyrido[3,2-b][1,4]oxazepin-3-yl]-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 130314192 |
| Molecular Formula | C22H19N5O3S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | 5-benzyl-4-cyano-N-[(2R,3S)-2,5-dimethyl-4-oxo-2,3-dihydropyrido[3,2-b][1,4]oxazepin-3-yl]-1,3-thiazole-2-carboxamide |
| SMILES | C[C@H]1Oc2cccnc2N(C)C(=O)[C@H]1NC(=O)c1nc(C#N)c(Cc2ccccc2)s1 |
| InChI | InChI=1S/C22H19N5O3S/c1-13-18(22(29)27(2)19-16(30-13)9-6-10-24-19)26-20(28)21-25-15(12-23)17(31-21)11-14-7-4-3-5-8-14/h3-10,13,18H,11H2,1-2H3,(H,26,28)/t13-,18+/m1/s1 |
| InChIKey | RSJMSEYLAANYDU-ACJLOTCBSA-N |
| XLogP | 2.54 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |