C16H12N2O3 — CID 130314503
(5E,6E)-5,6-di(ethylidene)-2-pyridin-3-yl-1,3-benzoxazole-4,7-dione (PubChem CID 130314503) has the molecular formula C16H12N2O3 and a molecular weight of 280.28 g/mol. Its IUPAC name is (5E,6E)-5,6-di(ethylidene)-2-pyridin-3-yl-1,3-benzoxazole-4,7-dione.
| Compound Name | (5E,6E)-5,6-di(ethylidene)-2-pyridin-3-yl-1,3-benzoxazole-4,7-dione |
|---|---|
| PubChem CID | 130314503 |
| Molecular Formula | C16H12N2O3 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | (5E,6E)-5,6-di(ethylidene)-2-pyridin-3-yl-1,3-benzoxazole-4,7-dione |
| SMILES | C/C=C1/C(=O)c2nc(-c3cccnc3)oc2C(=O)/C1=C/C |
| InChI | InChI=1S/C16H12N2O3/c1-3-10-11(4-2)14(20)15-12(13(10)19)18-16(21-15)9-6-5-7-17-8-9/h3-8H,1-2H3/b10-3+,11-4+ |
| InChIKey | SHRKELBYLMFETJ-HULALXFYSA-N |
| XLogP | 3.01 |
| TPSA | 73.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|