C17H23N — CID 130314997
(7Z,9Z)-N-methyl-11-(1-methylcyclopropyl)-6-methylideneundeca-2,3,7,9-tetraen-5-imine (PubChem CID 130314997) has the molecular formula C17H23N and a molecular weight of 241.38 g/mol. Its IUPAC name is (7Z,9Z)-N-methyl-11-(1-methylcyclopropyl)-6-methylideneundeca-2,3,7,9-tetraen-5-imine.
| Compound Name | (7Z,9Z)-N-methyl-11-(1-methylcyclopropyl)-6-methylideneundeca-2,3,7,9-tetraen-5-imine |
|---|---|
| PubChem CID | 130314997 |
| Molecular Formula | C17H23N |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | (7Z,9Z)-N-methyl-11-(1-methylcyclopropyl)-6-methylideneundeca-2,3,7,9-tetraen-5-imine |
| SMILES | C=C(/C=C\C=C/CC1(C)CC1)/C(C=C=CC)=N/C |
| InChI | InChI=1S/C17H23N/c1-5-6-11-16(18-4)15(2)10-8-7-9-12-17(3)13-14-17/h5,7-11H,2,12-14H2,1,3-4H3/b9-7-,10-8-,18-16+ |
| InChIKey | SNRYQIHZLDKJGW-YMHSPLDMSA-N |
| XLogP | 4.65 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|