About trans-methyl (1S,3S)-3-methyl-3-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]cyclopentane-1-carboxylate
trans-methyl (1S,3S)-3-methyl-3-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]cyclopentane-1-carboxylate (PubChem CID 130315404) has the molecular formula C15H26O4
and a molecular weight of 270.37 g/mol. Its IUPAC name is trans-methyl (1S,3S)-3-methyl-3-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]cyclopentane-1-carboxylate.
Molecular Properties
| Compound Name | trans-methyl (1S,3S)-3-methyl-3-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]cyclopentane-1-carboxylate |
| PubChem CID | 130315404 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | trans-methyl (1S,3S)-3-methyl-3-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]cyclopentane-1-carboxylate |
| SMILES | COC(=O)[C@H]1CC[C@@](C)(CCC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C15H26O4/c1-14(2,3)19-12(16)7-9-15(4)8-6-11(10-15)13(17)18-5/h11H,6-10H2,1-5H3/t11-,15-/m0/s1 |
| InChIKey | JDNGULYQOFIOBI-NHYWBVRUSA-N |
| XLogP | 3.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze trans-methyl (1S,3S)-3-methyl-3-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]cyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-methyl (1S,3S)-3-methyl-3-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]cyclopentane-1-carboxylate?
The IUPAC name of trans-methyl (1S,3S)-3-methyl-3-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]cyclopentane-1-carboxylate (CID 130315404) is trans-methyl (1S,3S)-3-methyl-3-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]cyclopentane-1-carboxylate.
What is the SMILES notation for trans-methyl (1S,3S)-3-methyl-3-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]cyclopentane-1-carboxylate?
The canonical SMILES for trans-methyl (1S,3S)-3-methyl-3-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]cyclopentane-1-carboxylate is COC(=O)[C@H]1CC[C@@](C)(CCC(=O)OC(C)(C)C)C1.
What is the InChIKey of trans-methyl (1S,3S)-3-methyl-3-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]cyclopentane-1-carboxylate?
The InChIKey is JDNGULYQOFIOBI-NHYWBVRUSA-N. The full InChI is InChI=1S/C15H26O4/c1-14(2,3)19-12(16)7-9-15(4)8-6-11(10-15)13(17)18-5/h11H,6-10H2,1-5H3/t11-,15-/m0/s1.
What are the key properties of trans-methyl (1S,3S)-3-methyl-3-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]cyclopentane-1-carboxylate?
trans-methyl (1S,3S)-3-methyl-3-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]cyclopentane-1-carboxylate has a molecular weight of 270.37 g/mol, XLogP of 3.09, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trans-methyl (1S,3S)-3-methyl-3-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]cyclopentane-1-carboxylate is sourced from PubChem (CID 130315404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).