C18H27FN6O — CID 130315523
(2S)-4-fluoro-1-[2-[[(1S,3R)-1,2,2-trimethyl-3-(1,2,4-triazol-1-ylmethyl)cyclopentyl]amino]acetyl]pyrrolidine-2-carbonitrile (PubChem CID 130315523) has the molecular formula C18H27FN6O and a molecular weight of 362.45 g/mol. Its IUPAC name is (2S)-4-fluoro-1-[2-[[(1S,3R)-1,2,2-trimethyl-3-(1,2,4-triazol-1-ylmethyl)cyclopentyl]amino]acetyl]pyrrolidine-2-carbonitrile.
| Compound Name | (2S)-4-fluoro-1-[2-[[(1S,3R)-1,2,2-trimethyl-3-(1,2,4-triazol-1-ylmethyl)cyclopentyl]amino]acetyl]pyrrolidine-2-carbonitrile |
|---|---|
| PubChem CID | 130315523 |
| Molecular Formula | C18H27FN6O |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | (2S)-4-fluoro-1-[2-[[(1S,3R)-1,2,2-trimethyl-3-(1,2,4-triazol-1-ylmethyl)cyclopentyl]amino]acetyl]pyrrolidine-2-carbonitrile |
| SMILES | CC1(C)[C@H](Cn2cncn2)CC[C@]1(C)NCC(=O)N1CC(F)C[C@H]1C#N |
| InChI | InChI=1S/C18H27FN6O/c1-17(2)13(9-24-12-21-11-23-24)4-5-18(17,3)22-8-16(26)25-10-14(19)6-15(25)7-20/h11-15,22H,4-6,8-10H2,1-3H3/t13-,14?,15-,18-/m0/s1 |
| InChIKey | ZFZVCKOOHHUNHE-XGVZATPDSA-N |
| XLogP | 1.53 |
| TPSA | 86.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |