About (3E,4E)-3,4-di(ethylidene)-1H-2-benzoxepin-5-one
(3E,4E)-3,4-di(ethylidene)-1H-2-benzoxepin-5-one (PubChem CID 130316300) has the molecular formula C14H14O2
and a molecular weight of 214.26 g/mol. Its IUPAC name is (3E,4E)-3,4-di(ethylidene)-1H-2-benzoxepin-5-one.
Molecular Properties
| Compound Name | (3E,4E)-3,4-di(ethylidene)-1H-2-benzoxepin-5-one |
| PubChem CID | 130316300 |
| Molecular Formula | C14H14O2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | (3E,4E)-3,4-di(ethylidene)-1H-2-benzoxepin-5-one |
| SMILES | C/C=C1/OCc2ccccc2C(=O)/C1=C/C |
| InChI | InChI=1S/C14H14O2/c1-3-11-13(4-2)16-9-10-7-5-6-8-12(10)14(11)15/h3-8H,9H2,1-2H3/b11-3+,13-4+ |
| InChIKey | OJXAAYBDJXGDNY-GFZHYVKTSA-N |
| XLogP | 3.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3E,4E)-3,4-di(ethylidene)-1H-2-benzoxepin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,4E)-3,4-di(ethylidene)-1H-2-benzoxepin-5-one?
The IUPAC name of (3E,4E)-3,4-di(ethylidene)-1H-2-benzoxepin-5-one (CID 130316300) is (3E,4E)-3,4-di(ethylidene)-1H-2-benzoxepin-5-one.
What is the SMILES notation for (3E,4E)-3,4-di(ethylidene)-1H-2-benzoxepin-5-one?
The canonical SMILES for (3E,4E)-3,4-di(ethylidene)-1H-2-benzoxepin-5-one is C/C=C1/OCc2ccccc2C(=O)/C1=C/C.
What is the InChIKey of (3E,4E)-3,4-di(ethylidene)-1H-2-benzoxepin-5-one?
The InChIKey is OJXAAYBDJXGDNY-GFZHYVKTSA-N. The full InChI is InChI=1S/C14H14O2/c1-3-11-13(4-2)16-9-10-7-5-6-8-12(10)14(11)15/h3-8H,9H2,1-2H3/b11-3+,13-4+.
What are the key properties of (3E,4E)-3,4-di(ethylidene)-1H-2-benzoxepin-5-one?
(3E,4E)-3,4-di(ethylidene)-1H-2-benzoxepin-5-one has a molecular weight of 214.26 g/mol, XLogP of 3.25, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,4E)-3,4-di(ethylidene)-1H-2-benzoxepin-5-one is sourced from PubChem (CID 130316300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).