C21H43NO — CID 130316412
3-[(E)-3,3,5,5,6,6-hexamethylnon-7-enoxy]-N,3-dimethylbutan-1-amine (PubChem CID 130316412) has the molecular formula C21H43NO and a molecular weight of 325.58 g/mol. Its IUPAC name is 3-[(E)-3,3,5,5,6,6-hexamethylnon-7-enoxy]-N,3-dimethylbutan-1-amine.
| Compound Name | 3-[(E)-3,3,5,5,6,6-hexamethylnon-7-enoxy]-N,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 130316412 |
| Molecular Formula | C21H43NO |
| Molecular Weight | 325.58 g/mol |
| Exact Mass | 325.33 |
| IUPAC Name | 3-[(E)-3,3,5,5,6,6-hexamethylnon-7-enoxy]-N,3-dimethylbutan-1-amine |
| SMILES | C/C=C/C(C)(C)C(C)(C)CC(C)(C)CCOC(C)(C)CCNC |
| InChI | InChI=1S/C21H43NO/c1-11-12-19(4,5)20(6,7)17-18(2,3)14-16-23-21(8,9)13-15-22-10/h11-12,22H,13-17H2,1-10H3/b12-11+ |
| InChIKey | JJUHEGROYZHLHO-VAWYXSNFSA-N |
| XLogP | 5.83 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.58 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|