C24H26O — CID 130316858
6-[[3-[(3E)-hexa-1,3,5-trien-3-yl]-2-methylphenyl]methoxy]-1,2,3,4-tetrahydronaphthalene (PubChem CID 130316858) has the molecular formula C24H26O and a molecular weight of 330.47 g/mol. Its IUPAC name is 6-[[3-[(3E)-hexa-1,3,5-trien-3-yl]-2-methylphenyl]methoxy]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 6-[[3-[(3E)-hexa-1,3,5-trien-3-yl]-2-methylphenyl]methoxy]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 130316858 |
| Molecular Formula | C24H26O |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | 6-[[3-[(3E)-hexa-1,3,5-trien-3-yl]-2-methylphenyl]methoxy]-1,2,3,4-tetrahydronaphthalene |
| SMILES | C=C/C=C(\C=C)c1cccc(COc2ccc3c(c2)CCCC3)c1C |
| InChI | InChI=1S/C24H26O/c1-4-9-19(5-2)24-13-8-12-22(18(24)3)17-25-23-15-14-20-10-6-7-11-21(20)16-23/h4-5,8-9,12-16H,1-2,6-7,10-11,17H2,3H3/b19-9+ |
| InChIKey | HAFZJDPRAISWGB-DJKKODMXSA-N |
| XLogP | 6.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|