C14H6F8O3S2 — CID 130316906
1-[2-(2,4-difluorophenyl)sulfonyl-1,1,2,2-tetrafluoroethyl]sulfinyl-2,4-difluorobenzene (PubChem CID 130316906) has the molecular formula C14H6F8O3S2 and a molecular weight of 438.32 g/mol. Its IUPAC name is 1-[2-(2,4-difluorophenyl)sulfonyl-1,1,2,2-tetrafluoroethyl]sulfinyl-2,4-difluorobenzene.
| Compound Name | 1-[2-(2,4-difluorophenyl)sulfonyl-1,1,2,2-tetrafluoroethyl]sulfinyl-2,4-difluorobenzene |
|---|---|
| PubChem CID | 130316906 |
| Molecular Formula | C14H6F8O3S2 |
| Molecular Weight | 438.32 g/mol |
| Exact Mass | 437.96 |
| IUPAC Name | 1-[2-(2,4-difluorophenyl)sulfonyl-1,1,2,2-tetrafluoroethyl]sulfinyl-2,4-difluorobenzene |
| SMILES | O=S(c1ccc(F)cc1F)C(F)(F)C(F)(F)S(=O)(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C14H6F8O3S2/c15-7-1-3-11(9(17)5-7)26(23)13(19,20)14(21,22)27(24,25)12-4-2-8(16)6-10(12)18/h1-6H |
| InChIKey | YIKJRQXFRXOLIF-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.32 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|