About (E)-1-N,2-N-dimethyl-1-methylsulfanylprop-1-ene-1,2-diamine
(E)-1-N,2-N-dimethyl-1-methylsulfanylprop-1-ene-1,2-diamine (PubChem CID 130317060) has the molecular formula C6H14N2S
and a molecular weight of 146.26 g/mol. Its IUPAC name is (E)-1-N,2-N-dimethyl-1-methylsulfanylprop-1-ene-1,2-diamine.
Molecular Properties
| Compound Name | (E)-1-N,2-N-dimethyl-1-methylsulfanylprop-1-ene-1,2-diamine |
| PubChem CID | 130317060 |
| Molecular Formula | C6H14N2S |
| Molecular Weight | 146.26 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | (E)-1-N,2-N-dimethyl-1-methylsulfanylprop-1-ene-1,2-diamine |
| SMILES | CN/C(C)=C(\NC)SC |
| InChI | InChI=1S/C6H14N2S/c1-5(7-2)6(8-3)9-4/h7-8H,1-4H3/b6-5+ |
| InChIKey | MWARSDDSYMDSMJ-AATRIKPKSA-N |
| XLogP | 0.98 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.26 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (E)-1-N,2-N-dimethyl-1-methylsulfanylprop-1-ene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-N,2-N-dimethyl-1-methylsulfanylprop-1-ene-1,2-diamine?
The IUPAC name of (E)-1-N,2-N-dimethyl-1-methylsulfanylprop-1-ene-1,2-diamine (CID 130317060) is (E)-1-N,2-N-dimethyl-1-methylsulfanylprop-1-ene-1,2-diamine.
What is the SMILES notation for (E)-1-N,2-N-dimethyl-1-methylsulfanylprop-1-ene-1,2-diamine?
The canonical SMILES for (E)-1-N,2-N-dimethyl-1-methylsulfanylprop-1-ene-1,2-diamine is CN/C(C)=C(\NC)SC.
What is the InChIKey of (E)-1-N,2-N-dimethyl-1-methylsulfanylprop-1-ene-1,2-diamine?
The InChIKey is MWARSDDSYMDSMJ-AATRIKPKSA-N. The full InChI is InChI=1S/C6H14N2S/c1-5(7-2)6(8-3)9-4/h7-8H,1-4H3/b6-5+.
What are the key properties of (E)-1-N,2-N-dimethyl-1-methylsulfanylprop-1-ene-1,2-diamine?
(E)-1-N,2-N-dimethyl-1-methylsulfanylprop-1-ene-1,2-diamine has a molecular weight of 146.26 g/mol, XLogP of 0.98, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-N,2-N-dimethyl-1-methylsulfanylprop-1-ene-1,2-diamine is sourced from PubChem (CID 130317060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).