C12H10N6O — CID 130317399
(2R,4S,5S)-5-azido-7-methyl-6-oxo-7,9-diazatricyclo[6.4.0.02,4]dodeca-1(8),9,11-triene-11-carbonitrile (PubChem CID 130317399) has the molecular formula C12H10N6O and a molecular weight of 254.25 g/mol. Its IUPAC name is (2R,4S,5S)-5-azido-7-methyl-6-oxo-7,9-diazatricyclo[6.4.0.02,4]dodeca-1(8),9,11-triene-11-carbonitrile.
| Compound Name | (2R,4S,5S)-5-azido-7-methyl-6-oxo-7,9-diazatricyclo[6.4.0.02,4]dodeca-1(8),9,11-triene-11-carbonitrile |
|---|---|
| PubChem CID | 130317399 |
| Molecular Formula | C12H10N6O |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | (2R,4S,5S)-5-azido-7-methyl-6-oxo-7,9-diazatricyclo[6.4.0.02,4]dodeca-1(8),9,11-triene-11-carbonitrile |
| SMILES | CN1C(=O)[C@@H](N=[N+]=[N-])[C@H]2C[C@H]2c2cc(C#N)cnc21 |
| InChI | InChI=1S/C12H10N6O/c1-18-11-9(2-6(4-13)5-15-11)7-3-8(7)10(12(18)19)16-17-14/h2,5,7-8,10H,3H2,1H3/t7-,8+,10+/m1/s1 |
| InChIKey | IYGPWSHUEFYZTO-WEDXCCLWSA-N |
| XLogP | 1.71 |
| TPSA | 105.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|