C23H16F3N5O2 — CID 130317436
N-[(1aS,2S,8bR)-5,7-difluoro-3-oxo-1a,2,4,8b-tetrahydro-1H-cyclopropa[d][1]benzazepin-2-yl]-1-[(3-cyanophenyl)methyl]-4-fluoropyrazole-3-carboxamide (PubChem CID 130317436) has the molecular formula C23H16F3N5O2 and a molecular weight of 451.41 g/mol. Its IUPAC name is N-[(1aS,2S,8bR)-5,7-difluoro-3-oxo-1a,2,4,8b-tetrahydro-1H-cyclopropa[d][1]benzazepin-2-yl]-1-[(3-cyanophenyl)methyl]-4-fluoropyrazole-3-carboxamide.
| Compound Name | N-[(1aS,2S,8bR)-5,7-difluoro-3-oxo-1a,2,4,8b-tetrahydro-1H-cyclopropa[d][1]benzazepin-2-yl]-1-[(3-cyanophenyl)methyl]-4-fluoropyrazole-3-carboxamide |
|---|---|
| PubChem CID | 130317436 |
| Molecular Formula | C23H16F3N5O2 |
| Molecular Weight | 451.41 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | N-[(1aS,2S,8bR)-5,7-difluoro-3-oxo-1a,2,4,8b-tetrahydro-1H-cyclopropa[d][1]benzazepin-2-yl]-1-[(3-cyanophenyl)methyl]-4-fluoropyrazole-3-carboxamide |
| SMILES | N#Cc1cccc(Cn2cc(F)c(C(=O)N[C@@H]3C(=O)Nc4c(F)cc(F)cc4[C@@H]4C[C@H]34)n2)c1 |
| InChI | InChI=1S/C23H16F3N5O2/c24-13-5-15-14-7-16(14)20(22(32)28-19(15)17(25)6-13)29-23(33)21-18(26)10-31(30-21)9-12-3-1-2-11(4-12)8-27/h1-6,10,14,16,20H,7,9H2,(H,28,32)(H,29,33)/t14-,16-,20-/m0/s1 |
| InChIKey | FLVHGNLLBJCQJV-UVFQYZLESA-N |
| XLogP | 3.07 |
| TPSA | 99.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.41 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |