C16H26FN — CID 130317615
(2Z,6Z,7E)-N-ethyl-6-ethylidene-9-fluoro-N,2-dimethyl-4-methylidenenona-2,7-dien-1-amine (PubChem CID 130317615) has the molecular formula C16H26FN and a molecular weight of 251.39 g/mol. Its IUPAC name is (2Z,6Z,7E)-N-ethyl-6-ethylidene-9-fluoro-N,2-dimethyl-4-methylidenenona-2,7-dien-1-amine.
| Compound Name | (2Z,6Z,7E)-N-ethyl-6-ethylidene-9-fluoro-N,2-dimethyl-4-methylidenenona-2,7-dien-1-amine |
|---|---|
| PubChem CID | 130317615 |
| Molecular Formula | C16H26FN |
| Molecular Weight | 251.39 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | (2Z,6Z,7E)-N-ethyl-6-ethylidene-9-fluoro-N,2-dimethyl-4-methylidenenona-2,7-dien-1-amine |
| SMILES | C=C(/C=C(/C)CN(C)CC)CC(=C/C)/C=C/CF |
| InChI | InChI=1S/C16H26FN/c1-6-16(9-8-10-17)12-14(3)11-15(4)13-18(5)7-2/h6,8-9,11H,3,7,10,12-13H2,1-2,4-5H3/b9-8+,15-11-,16-6+ |
| InChIKey | IEVPNSCGIBUVHP-IZJQZKCZSA-N |
| XLogP | 4.30 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.39 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|