C11H13N5 — CID 130317639
6-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-1,3,5-triazine-2,4-diamine (PubChem CID 130317639) has the molecular formula C11H13N5 and a molecular weight of 215.26 g/mol. Its IUPAC name is 6-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 130317639 |
| Molecular Formula | C11H13N5 |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 6-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-1,3,5-triazine-2,4-diamine |
| SMILES | C=C/C=C\C(=C/C=C)c1nc(N)nc(N)n1 |
| InChI | InChI=1S/C11H13N5/c1-3-5-7-8(6-4-2)9-14-10(12)16-11(13)15-9/h3-7H,1-2H2,(H4,12,13,14,15,16)/b7-5-,8-6+ |
| InChIKey | ZFQBFDXBHYXHJP-CGXWXWIYSA-N |
| XLogP | 1.35 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|