C26H20O6P2 — CID 130317683
[4-[10-(4-phosphonophenyl)anthracen-9-yl]phenyl]phosphonic acid (PubChem CID 130317683) has the molecular formula C26H20O6P2 and a molecular weight of 490.39 g/mol. Its IUPAC name is [4-[10-(4-phosphonophenyl)anthracen-9-yl]phenyl]phosphonic acid.
| Compound Name | [4-[10-(4-phosphonophenyl)anthracen-9-yl]phenyl]phosphonic acid |
|---|---|
| PubChem CID | 130317683 |
| Molecular Formula | C26H20O6P2 |
| Molecular Weight | 490.39 g/mol |
| Exact Mass | 490.07 |
| IUPAC Name | [4-[10-(4-phosphonophenyl)anthracen-9-yl]phenyl]phosphonic acid |
| SMILES | O=P(O)(O)c1ccc(-c2c3ccccc3c(-c3ccc(P(=O)(O)O)cc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C26H20O6P2/c27-33(28,29)19-13-9-17(10-14-19)25-21-5-1-2-6-22(21)26(24-8-4-3-7-23(24)25)18-11-15-20(16-12-18)34(30,31)32/h1-16H,(H2,27,28,29)(H2,30,31,32) |
| InChIKey | DGDXOSUEQAAXDO-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.39 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|