C15H21N — CID 130317733
N-[(2Z,4Z,6E,7Z)-8-methyl-6-prop-2-enylidenedeca-2,4,7-trien-5-yl]methanimine (PubChem CID 130317733) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is N-[(2Z,4Z,6E,7Z)-8-methyl-6-prop-2-enylidenedeca-2,4,7-trien-5-yl]methanimine.
| Compound Name | N-[(2Z,4Z,6E,7Z)-8-methyl-6-prop-2-enylidenedeca-2,4,7-trien-5-yl]methanimine |
|---|---|
| PubChem CID | 130317733 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | N-[(2Z,4Z,6E,7Z)-8-methyl-6-prop-2-enylidenedeca-2,4,7-trien-5-yl]methanimine |
| SMILES | C=C/C=C(\C=C(\C)CC)C(=C\C=C/C)/N=C |
| InChI | InChI=1S/C15H21N/c1-6-9-11-15(16-5)14(10-7-2)12-13(4)8-3/h6-7,9-12H,2,5,8H2,1,3-4H3/b9-6-,13-12-,14-10+,15-11- |
| InChIKey | QQROZHMCQGMJJG-LGRDJRGSSA-N |
| XLogP | 4.62 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|