C28H36O9 — CID 130317743
(1R,2S,4R)-4-[4-[(3R,6S)-6-(3,4-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-2-methylphenoxy]-6-(hydroxymethyl)cyclohexane-1,2,3-triol (PubChem CID 130317743) has the molecular formula C28H36O9 and a molecular weight of 516.59 g/mol. Its IUPAC name is (1R,2S,4R)-4-[4-[(3R,6S)-6-(3,4-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-2-methylphenoxy]-6-(hydroxymethyl)cyclohexane-1,2,3-triol.
| Compound Name | (1R,2S,4R)-4-[4-[(3R,6S)-6-(3,4-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-2-methylphenoxy]-6-(hydroxymethyl)cyclohexane-1,2,3-triol |
|---|---|
| PubChem CID | 130317743 |
| Molecular Formula | C28H36O9 |
| Molecular Weight | 516.59 g/mol |
| Exact Mass | 516.24 |
| IUPAC Name | (1R,2S,4R)-4-[4-[(3R,6S)-6-(3,4-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-2-methylphenoxy]-6-(hydroxymethyl)cyclohexane-1,2,3-triol |
| SMILES | COc1ccc([C@H]2OCC3C2CO[C@H]3c2ccc(O[C@@H]3CC(CO)[C@@H](O)[C@H](O)C3O)c(C)c2)cc1OC |
| InChI | InChI=1S/C28H36O9/c1-14-8-15(4-6-20(14)37-23-10-17(11-29)24(30)26(32)25(23)31)27-18-12-36-28(19(18)13-35-27)16-5-7-21(33-2)22(9-16)34-3/h4-9,17-19,23-32H,10-13H2,1-3H3/t17?,18?,19?,23-,24-,25?,26+,27+,28-/m1/s1 |
| InChIKey | OTGOJCVHCBSNEL-YIDDFOBUSA-N |
| XLogP | 1.93 |
| TPSA | 127.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.59 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |