About 4,7-bis(5-methylthiophen-2-yl)thiadiazolo[5,4-c]pyridine
4,7-bis(5-methylthiophen-2-yl)thiadiazolo[5,4-c]pyridine (PubChem CID 130317903) has the molecular formula C15H11N3S3
and a molecular weight of 329.48 g/mol. Its IUPAC name is 4,7-bis(5-methylthiophen-2-yl)thiadiazolo[5,4-c]pyridine.
Molecular Properties
| Compound Name | 4,7-bis(5-methylthiophen-2-yl)thiadiazolo[5,4-c]pyridine |
| PubChem CID | 130317903 |
| Molecular Formula | C15H11N3S3 |
| Molecular Weight | 329.48 g/mol |
| Exact Mass | 329.01 |
| IUPAC Name | 4,7-bis(5-methylthiophen-2-yl)thiadiazolo[5,4-c]pyridine |
| SMILES | Cc1ccc(-c2cnc(-c3ccc(C)s3)c3snnc23)s1 |
| InChI | InChI=1S/C15H11N3S3/c1-8-3-5-11(19-8)10-7-16-14(12-6-4-9(2)20-12)15-13(10)17-18-21-15/h3-7H,1-2H3 |
| InChIKey | KORKHDRRZNHWJM-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 329.48 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4,7-bis(5-methylthiophen-2-yl)thiadiazolo[5,4-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-bis(5-methylthiophen-2-yl)thiadiazolo[5,4-c]pyridine?
The IUPAC name of 4,7-bis(5-methylthiophen-2-yl)thiadiazolo[5,4-c]pyridine (CID 130317903) is 4,7-bis(5-methylthiophen-2-yl)thiadiazolo[5,4-c]pyridine.
What is the SMILES notation for 4,7-bis(5-methylthiophen-2-yl)thiadiazolo[5,4-c]pyridine?
The canonical SMILES for 4,7-bis(5-methylthiophen-2-yl)thiadiazolo[5,4-c]pyridine is Cc1ccc(-c2cnc(-c3ccc(C)s3)c3snnc23)s1.
What is the InChIKey of 4,7-bis(5-methylthiophen-2-yl)thiadiazolo[5,4-c]pyridine?
The InChIKey is KORKHDRRZNHWJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N3S3/c1-8-3-5-11(19-8)10-7-16-14(12-6-4-9(2)20-12)15-13(10)17-18-21-15/h3-7H,1-2H3.
What are the key properties of 4,7-bis(5-methylthiophen-2-yl)thiadiazolo[5,4-c]pyridine?
4,7-bis(5-methylthiophen-2-yl)thiadiazolo[5,4-c]pyridine has a molecular weight of 329.48 g/mol, XLogP of 5.16, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-bis(5-methylthiophen-2-yl)thiadiazolo[5,4-c]pyridine is sourced from PubChem (CID 130317903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).