About 6-fluoro-4,7-bis(5-methylthiophen-2-yl)thiadiazolo[4,5-c]pyridine
6-fluoro-4,7-bis(5-methylthiophen-2-yl)thiadiazolo[4,5-c]pyridine (PubChem CID 130317909) has the molecular formula C15H10FN3S3
and a molecular weight of 347.47 g/mol. Its IUPAC name is 6-fluoro-4,7-bis(5-methylthiophen-2-yl)thiadiazolo[4,5-c]pyridine.
Molecular Properties
| Compound Name | 6-fluoro-4,7-bis(5-methylthiophen-2-yl)thiadiazolo[4,5-c]pyridine |
| PubChem CID | 130317909 |
| Molecular Formula | C15H10FN3S3 |
| Molecular Weight | 347.47 g/mol |
| Exact Mass | 347.00 |
| IUPAC Name | 6-fluoro-4,7-bis(5-methylthiophen-2-yl)thiadiazolo[4,5-c]pyridine |
| SMILES | Cc1ccc(-c2nc(F)c(-c3ccc(C)s3)c3snnc23)s1 |
| InChI | InChI=1S/C15H10FN3S3/c1-7-3-5-9(20-7)11-14-13(18-19-22-14)12(17-15(11)16)10-6-4-8(2)21-10/h3-6H,1-2H3 |
| InChIKey | HFCSMMNGQSHSSO-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.47 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-fluoro-4,7-bis(5-methylthiophen-2-yl)thiadiazolo[4,5-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-4,7-bis(5-methylthiophen-2-yl)thiadiazolo[4,5-c]pyridine?
The IUPAC name of 6-fluoro-4,7-bis(5-methylthiophen-2-yl)thiadiazolo[4,5-c]pyridine (CID 130317909) is 6-fluoro-4,7-bis(5-methylthiophen-2-yl)thiadiazolo[4,5-c]pyridine.
What is the SMILES notation for 6-fluoro-4,7-bis(5-methylthiophen-2-yl)thiadiazolo[4,5-c]pyridine?
The canonical SMILES for 6-fluoro-4,7-bis(5-methylthiophen-2-yl)thiadiazolo[4,5-c]pyridine is Cc1ccc(-c2nc(F)c(-c3ccc(C)s3)c3snnc23)s1.
What is the InChIKey of 6-fluoro-4,7-bis(5-methylthiophen-2-yl)thiadiazolo[4,5-c]pyridine?
The InChIKey is HFCSMMNGQSHSSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10FN3S3/c1-7-3-5-9(20-7)11-14-13(18-19-22-14)12(17-15(11)16)10-6-4-8(2)21-10/h3-6H,1-2H3.
What are the key properties of 6-fluoro-4,7-bis(5-methylthiophen-2-yl)thiadiazolo[4,5-c]pyridine?
6-fluoro-4,7-bis(5-methylthiophen-2-yl)thiadiazolo[4,5-c]pyridine has a molecular weight of 347.47 g/mol, XLogP of 5.30, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-4,7-bis(5-methylthiophen-2-yl)thiadiazolo[4,5-c]pyridine is sourced from PubChem (CID 130317909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).