C24H20N2O2S — CID 130318322
4,7-bis(4-prop-2-enoxyphenyl)-2,1,3-benzothiadiazole (PubChem CID 130318322) has the molecular formula C24H20N2O2S and a molecular weight of 400.50 g/mol. Its IUPAC name is 4,7-bis(4-prop-2-enoxyphenyl)-2,1,3-benzothiadiazole.
| Compound Name | 4,7-bis(4-prop-2-enoxyphenyl)-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 130318322 |
| Molecular Formula | C24H20N2O2S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 4,7-bis(4-prop-2-enoxyphenyl)-2,1,3-benzothiadiazole |
| SMILES | C=CCOc1ccc(-c2ccc(-c3ccc(OCC=C)cc3)c3nsnc23)cc1 |
| InChI | InChI=1S/C24H20N2O2S/c1-3-15-27-19-9-5-17(6-10-19)21-13-14-22(24-23(21)25-29-26-24)18-7-11-20(12-8-18)28-16-4-2/h3-14H,1-2,15-16H2 |
| InChIKey | BNNZSDJUPGBNCO-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|