About 4,6-diethyl-3H-thieno[3,4-c]pyrazole
4,6-diethyl-3H-thieno[3,4-c]pyrazole (PubChem CID 130318337) has the molecular formula C9H12N2S
and a molecular weight of 180.28 g/mol. Its IUPAC name is 4,6-diethyl-3H-thieno[3,4-c]pyrazole.
Molecular Properties
| Compound Name | 4,6-diethyl-3H-thieno[3,4-c]pyrazole |
| PubChem CID | 130318337 |
| Molecular Formula | C9H12N2S |
| Molecular Weight | 180.28 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | 4,6-diethyl-3H-thieno[3,4-c]pyrazole |
| SMILES | CCc1sc(CC)c2c1CN=N2 |
| InChI | InChI=1S/C9H12N2S/c1-3-7-6-5-10-11-9(6)8(4-2)12-7/h3-5H2,1-2H3 |
| InChIKey | BJQGXOIVIJDOPY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.28 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,6-diethyl-3H-thieno[3,4-c]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-diethyl-3H-thieno[3,4-c]pyrazole?
The IUPAC name of 4,6-diethyl-3H-thieno[3,4-c]pyrazole (CID 130318337) is 4,6-diethyl-3H-thieno[3,4-c]pyrazole.
What is the SMILES notation for 4,6-diethyl-3H-thieno[3,4-c]pyrazole?
The canonical SMILES for 4,6-diethyl-3H-thieno[3,4-c]pyrazole is CCc1sc(CC)c2c1CN=N2.
What is the InChIKey of 4,6-diethyl-3H-thieno[3,4-c]pyrazole?
The InChIKey is BJQGXOIVIJDOPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2S/c1-3-7-6-5-10-11-9(6)8(4-2)12-7/h3-5H2,1-2H3.
What are the key properties of 4,6-diethyl-3H-thieno[3,4-c]pyrazole?
4,6-diethyl-3H-thieno[3,4-c]pyrazole has a molecular weight of 180.28 g/mol, XLogP of 3.47, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-diethyl-3H-thieno[3,4-c]pyrazole is sourced from PubChem (CID 130318337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).