About 4,6-dithiophen-2-ylthieno[3,4-d]thiadiazole
4,6-dithiophen-2-ylthieno[3,4-d]thiadiazole (PubChem CID 130318353) has the molecular formula C12H6N2S4
and a molecular weight of 306.46 g/mol. Its IUPAC name is 4,6-dithiophen-2-ylthieno[3,4-d]thiadiazole.
Molecular Properties
| Compound Name | 4,6-dithiophen-2-ylthieno[3,4-d]thiadiazole |
| PubChem CID | 130318353 |
| Molecular Formula | C12H6N2S4 |
| Molecular Weight | 306.46 g/mol |
| Exact Mass | 305.94 |
| IUPAC Name | 4,6-dithiophen-2-ylthieno[3,4-d]thiadiazole |
| SMILES | c1csc(-c2sc(-c3cccs3)c3snnc23)c1 |
| InChI | InChI=1S/C12H6N2S4/c1-3-7(15-5-1)10-9-12(18-14-13-9)11(17-10)8-4-2-6-16-8/h1-6H |
| InChIKey | YBVDMHFUSUOUPH-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.46 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4,6-dithiophen-2-ylthieno[3,4-d]thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dithiophen-2-ylthieno[3,4-d]thiadiazole?
The IUPAC name of 4,6-dithiophen-2-ylthieno[3,4-d]thiadiazole (CID 130318353) is 4,6-dithiophen-2-ylthieno[3,4-d]thiadiazole.
What is the SMILES notation for 4,6-dithiophen-2-ylthieno[3,4-d]thiadiazole?
The canonical SMILES for 4,6-dithiophen-2-ylthieno[3,4-d]thiadiazole is c1csc(-c2sc(-c3cccs3)c3snnc23)c1.
What is the InChIKey of 4,6-dithiophen-2-ylthieno[3,4-d]thiadiazole?
The InChIKey is YBVDMHFUSUOUPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6N2S4/c1-3-7(15-5-1)10-9-12(18-14-13-9)11(17-10)8-4-2-6-16-8/h1-6H.
What are the key properties of 4,6-dithiophen-2-ylthieno[3,4-d]thiadiazole?
4,6-dithiophen-2-ylthieno[3,4-d]thiadiazole has a molecular weight of 306.46 g/mol, XLogP of 5.21, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dithiophen-2-ylthieno[3,4-d]thiadiazole is sourced from PubChem (CID 130318353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).