About 5-(3-tert-butylphenyl)-2,3-dihydro-1H-pyrrolizine
5-(3-tert-butylphenyl)-2,3-dihydro-1H-pyrrolizine (PubChem CID 130318480) has the molecular formula C17H21N
and a molecular weight of 239.36 g/mol. Its IUPAC name is 5-(3-tert-butylphenyl)-2,3-dihydro-1H-pyrrolizine.
Molecular Properties
| Compound Name | 5-(3-tert-butylphenyl)-2,3-dihydro-1H-pyrrolizine |
| PubChem CID | 130318480 |
| Molecular Formula | C17H21N |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | 5-(3-tert-butylphenyl)-2,3-dihydro-1H-pyrrolizine |
| SMILES | CC(C)(C)c1cccc(-c2ccc3n2CCC3)c1 |
| InChI | InChI=1S/C17H21N/c1-17(2,3)14-7-4-6-13(12-14)16-10-9-15-8-5-11-18(15)16/h4,6-7,9-10,12H,5,8,11H2,1-3H3 |
| InChIKey | CEXMWPRAUDTQNT-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_C(8)', 'substructure': 'N/A'} |
|---|
Analyze 5-(3-tert-butylphenyl)-2,3-dihydro-1H-pyrrolizine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-tert-butylphenyl)-2,3-dihydro-1H-pyrrolizine?
The IUPAC name of 5-(3-tert-butylphenyl)-2,3-dihydro-1H-pyrrolizine (CID 130318480) is 5-(3-tert-butylphenyl)-2,3-dihydro-1H-pyrrolizine.
What is the SMILES notation for 5-(3-tert-butylphenyl)-2,3-dihydro-1H-pyrrolizine?
The canonical SMILES for 5-(3-tert-butylphenyl)-2,3-dihydro-1H-pyrrolizine is CC(C)(C)c1cccc(-c2ccc3n2CCC3)c1.
What is the InChIKey of 5-(3-tert-butylphenyl)-2,3-dihydro-1H-pyrrolizine?
The InChIKey is CEXMWPRAUDTQNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N/c1-17(2,3)14-7-4-6-13(12-14)16-10-9-15-8-5-11-18(15)16/h4,6-7,9-10,12H,5,8,11H2,1-3H3.
What are the key properties of 5-(3-tert-butylphenyl)-2,3-dihydro-1H-pyrrolizine?
5-(3-tert-butylphenyl)-2,3-dihydro-1H-pyrrolizine has a molecular weight of 239.36 g/mol, XLogP of 4.40, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-tert-butylphenyl)-2,3-dihydro-1H-pyrrolizine is sourced from PubChem (CID 130318480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).