About 4,5-dimethyl-2-(2-methylpropyl)-2,3-dihydropyran-6-one
4,5-dimethyl-2-(2-methylpropyl)-2,3-dihydropyran-6-one (PubChem CID 130318501) has the molecular formula C11H18O2
and a molecular weight of 182.26 g/mol. Its IUPAC name is 4,5-dimethyl-2-(2-methylpropyl)-2,3-dihydropyran-6-one.
Molecular Properties
| Compound Name | 4,5-dimethyl-2-(2-methylpropyl)-2,3-dihydropyran-6-one |
| PubChem CID | 130318501 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | 4,5-dimethyl-2-(2-methylpropyl)-2,3-dihydropyran-6-one |
| SMILES | CC1=C(C)C(=O)OC(CC(C)C)C1 |
| InChI | InChI=1S/C11H18O2/c1-7(2)5-10-6-8(3)9(4)11(12)13-10/h7,10H,5-6H2,1-4H3 |
| InChIKey | VKLUTFDWSCHUPW-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,5-dimethyl-2-(2-methylpropyl)-2,3-dihydropyran-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-2-(2-methylpropyl)-2,3-dihydropyran-6-one?
The IUPAC name of 4,5-dimethyl-2-(2-methylpropyl)-2,3-dihydropyran-6-one (CID 130318501) is 4,5-dimethyl-2-(2-methylpropyl)-2,3-dihydropyran-6-one.
What is the SMILES notation for 4,5-dimethyl-2-(2-methylpropyl)-2,3-dihydropyran-6-one?
The canonical SMILES for 4,5-dimethyl-2-(2-methylpropyl)-2,3-dihydropyran-6-one is CC1=C(C)C(=O)OC(CC(C)C)C1.
What is the InChIKey of 4,5-dimethyl-2-(2-methylpropyl)-2,3-dihydropyran-6-one?
The InChIKey is VKLUTFDWSCHUPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O2/c1-7(2)5-10-6-8(3)9(4)11(12)13-10/h7,10H,5-6H2,1-4H3.
What are the key properties of 4,5-dimethyl-2-(2-methylpropyl)-2,3-dihydropyran-6-one?
4,5-dimethyl-2-(2-methylpropyl)-2,3-dihydropyran-6-one has a molecular weight of 182.26 g/mol, XLogP of 2.68, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-2-(2-methylpropyl)-2,3-dihydropyran-6-one is sourced from PubChem (CID 130318501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).