C14H18O2 — CID 130318621
(1aR,1bR,2R)-1,1,1b,2-tetramethyl-1a,2,3,6a-tetrahydrocyclopropa[a]indene-4,6-dione (PubChem CID 130318621) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is (1aR,1bR,2R)-1,1,1b,2-tetramethyl-1a,2,3,6a-tetrahydrocyclopropa[a]indene-4,6-dione.
| Compound Name | (1aR,1bR,2R)-1,1,1b,2-tetramethyl-1a,2,3,6a-tetrahydrocyclopropa[a]indene-4,6-dione |
|---|---|
| PubChem CID | 130318621 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | (1aR,1bR,2R)-1,1,1b,2-tetramethyl-1a,2,3,6a-tetrahydrocyclopropa[a]indene-4,6-dione |
| SMILES | C[C@@H]1CC(=O)C=C2C(=O)C3[C@H](C3(C)C)[C@]21C |
| InChI | InChI=1S/C14H18O2/c1-7-5-8(15)6-9-11(16)10-12(13(10,2)3)14(7,9)4/h6-7,10,12H,5H2,1-4H3/t7-,10?,12-,14+/m1/s1 |
| InChIKey | JFKBBEXHGRBITG-YKMABWHXSA-N |
| XLogP | 2.38 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |