C17H13F4N2P — CID 130318739
diphenyl-(1,1,2,2-tetrafluoro-2-imidazol-1-ylethyl)phosphane (PubChem CID 130318739) has the molecular formula C17H13F4N2P and a molecular weight of 352.27 g/mol. Its IUPAC name is diphenyl-(1,1,2,2-tetrafluoro-2-imidazol-1-ylethyl)phosphane.
| Compound Name | diphenyl-(1,1,2,2-tetrafluoro-2-imidazol-1-ylethyl)phosphane |
|---|---|
| PubChem CID | 130318739 |
| Molecular Formula | C17H13F4N2P |
| Molecular Weight | 352.27 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | diphenyl-(1,1,2,2-tetrafluoro-2-imidazol-1-ylethyl)phosphane |
| SMILES | FC(F)(n1ccnc1)C(F)(F)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H13F4N2P/c18-16(19,23-12-11-22-13-23)17(20,21)24(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-13H |
| InChIKey | GODCPQFLOHPBRT-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.27 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|