About (4-methylcyclohexa-1,3-dien-1-yl)-morpholin-4-ylmethanone
(4-methylcyclohexa-1,3-dien-1-yl)-morpholin-4-ylmethanone (PubChem CID 130319050) has the molecular formula C12H17NO2
and a molecular weight of 207.27 g/mol. Its IUPAC name is (4-methylcyclohexa-1,3-dien-1-yl)-morpholin-4-ylmethanone.
Molecular Properties
| Compound Name | (4-methylcyclohexa-1,3-dien-1-yl)-morpholin-4-ylmethanone |
| PubChem CID | 130319050 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | (4-methylcyclohexa-1,3-dien-1-yl)-morpholin-4-ylmethanone |
| SMILES | CC1=CC=C(C(=O)N2CCOCC2)CC1 |
| InChI | InChI=1S/C12H17NO2/c1-10-2-4-11(5-3-10)12(14)13-6-8-15-9-7-13/h2,4H,3,5-9H2,1H3 |
| InChIKey | ZXLCJJQDXTWVDH-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-methylcyclohexa-1,3-dien-1-yl)-morpholin-4-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylcyclohexa-1,3-dien-1-yl)-morpholin-4-ylmethanone?
The IUPAC name of (4-methylcyclohexa-1,3-dien-1-yl)-morpholin-4-ylmethanone (CID 130319050) is (4-methylcyclohexa-1,3-dien-1-yl)-morpholin-4-ylmethanone.
What is the SMILES notation for (4-methylcyclohexa-1,3-dien-1-yl)-morpholin-4-ylmethanone?
The canonical SMILES for (4-methylcyclohexa-1,3-dien-1-yl)-morpholin-4-ylmethanone is CC1=CC=C(C(=O)N2CCOCC2)CC1.
What is the InChIKey of (4-methylcyclohexa-1,3-dien-1-yl)-morpholin-4-ylmethanone?
The InChIKey is ZXLCJJQDXTWVDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO2/c1-10-2-4-11(5-3-10)12(14)13-6-8-15-9-7-13/h2,4H,3,5-9H2,1H3.
What are the key properties of (4-methylcyclohexa-1,3-dien-1-yl)-morpholin-4-ylmethanone?
(4-methylcyclohexa-1,3-dien-1-yl)-morpholin-4-ylmethanone has a molecular weight of 207.27 g/mol, XLogP of 1.51, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylcyclohexa-1,3-dien-1-yl)-morpholin-4-ylmethanone is sourced from PubChem (CID 130319050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).