C10H15NO — CID 130319349
N-methyl-3,4,6,7-tetrahydro-2H-chromen-2-amine (PubChem CID 130319349) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is N-methyl-3,4,6,7-tetrahydro-2H-chromen-2-amine.
| Compound Name | N-methyl-3,4,6,7-tetrahydro-2H-chromen-2-amine |
|---|---|
| PubChem CID | 130319349 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | N-methyl-3,4,6,7-tetrahydro-2H-chromen-2-amine |
| SMILES | CNC1CCC2=CCCC=C2O1 |
| InChI | InChI=1S/C10H15NO/c1-11-10-7-6-8-4-2-3-5-9(8)12-10/h4-5,10-11H,2-3,6-7H2,1H3 |
| InChIKey | UVQADOVKVBGVFN-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |