About (3-benzoyl-2-methyl-1,1-dioxo-1lambda6,2-benzothiazin-4-yl) 4-methylbenzoate
(3-benzoyl-2-methyl-1,1-dioxo-1lambda6,2-benzothiazin-4-yl) 4-methylbenzoate (PubChem CID 1303196) has the molecular formula C24H19NO5S
and a molecular weight of 433.49 g/mol. Its IUPAC name is (3-benzoyl-2-methyl-1,1-dioxo-1lambda6,2-benzothiazin-4-yl) 4-methylbenzoate.
Molecular Properties
| Compound Name | (3-benzoyl-2-methyl-1,1-dioxo-1lambda6,2-benzothiazin-4-yl) 4-methylbenzoate |
| PubChem CID | 1303196 |
| Molecular Formula | C24H19NO5S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | (3-benzoyl-2-methyl-1,1-dioxo-1lambda6,2-benzothiazin-4-yl) 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OC2=C(C(=O)c3ccccc3)N(C)S(=O)(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C24H19NO5S/c1-16-12-14-18(15-13-16)24(27)30-23-19-10-6-7-11-20(19)31(28,29)25(2)21(23)22(26)17-8-4-3-5-9-17/h3-15H,1-2H3 |
| InChIKey | IBGHHJGJVBAOEO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3-benzoyl-2-methyl-1,1-dioxo-1lambda6,2-benzothiazin-4-yl) 4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-benzoyl-2-methyl-1,1-dioxo-1lambda6,2-benzothiazin-4-yl) 4-methylbenzoate?
The IUPAC name of (3-benzoyl-2-methyl-1,1-dioxo-1lambda6,2-benzothiazin-4-yl) 4-methylbenzoate (CID 1303196) is (3-benzoyl-2-methyl-1,1-dioxo-1lambda6,2-benzothiazin-4-yl) 4-methylbenzoate.
What is the SMILES notation for (3-benzoyl-2-methyl-1,1-dioxo-1lambda6,2-benzothiazin-4-yl) 4-methylbenzoate?
The canonical SMILES for (3-benzoyl-2-methyl-1,1-dioxo-1lambda6,2-benzothiazin-4-yl) 4-methylbenzoate is Cc1ccc(C(=O)OC2=C(C(=O)c3ccccc3)N(C)S(=O)(=O)c3ccccc32)cc1.
What is the InChIKey of (3-benzoyl-2-methyl-1,1-dioxo-1lambda6,2-benzothiazin-4-yl) 4-methylbenzoate?
The InChIKey is IBGHHJGJVBAOEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19NO5S/c1-16-12-14-18(15-13-16)24(27)30-23-19-10-6-7-11-20(19)31(28,29)25(2)21(23)22(26)17-8-4-3-5-9-17/h3-15H,1-2H3.
What are the key properties of (3-benzoyl-2-methyl-1,1-dioxo-1lambda6,2-benzothiazin-4-yl) 4-methylbenzoate?
(3-benzoyl-2-methyl-1,1-dioxo-1lambda6,2-benzothiazin-4-yl) 4-methylbenzoate has a molecular weight of 433.49 g/mol, XLogP of 4.04, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-benzoyl-2-methyl-1,1-dioxo-1lambda6,2-benzothiazin-4-yl) 4-methylbenzoate is sourced from PubChem (CID 1303196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).