C20H28F3NO — CID 130319661
N-ethyl-2,2,2-trifluoro-N-[[4-[2-(1-methoxyethenyl)-3-methylbut-3-enyl]-3-methylphenyl]methyl]ethanamine (PubChem CID 130319661) has the molecular formula C20H28F3NO and a molecular weight of 355.44 g/mol. Its IUPAC name is N-ethyl-2,2,2-trifluoro-N-[[4-[2-(1-methoxyethenyl)-3-methylbut-3-enyl]-3-methylphenyl]methyl]ethanamine.
| Compound Name | N-ethyl-2,2,2-trifluoro-N-[[4-[2-(1-methoxyethenyl)-3-methylbut-3-enyl]-3-methylphenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 130319661 |
| Molecular Formula | C20H28F3NO |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | N-ethyl-2,2,2-trifluoro-N-[[4-[2-(1-methoxyethenyl)-3-methylbut-3-enyl]-3-methylphenyl]methyl]ethanamine |
| SMILES | C=C(C)C(Cc1ccc(CN(CC)CC(F)(F)F)cc1C)C(=C)OC |
| InChI | InChI=1S/C20H28F3NO/c1-7-24(13-20(21,22)23)12-17-8-9-18(15(4)10-17)11-19(14(2)3)16(5)25-6/h8-10,19H,2,5,7,11-13H2,1,3-4,6H3 |
| InChIKey | ALCTUACMSPXVSQ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|