About 1-iodo-3-methylthieno[3,2-d]pyrazole
1-iodo-3-methylthieno[3,2-d]pyrazole (PubChem CID 130319733) has the molecular formula C6H5IN2S
and a molecular weight of 264.09 g/mol. Its IUPAC name is 1-iodo-3-methylthieno[3,2-d]pyrazole.
Molecular Properties
| Compound Name | 1-iodo-3-methylthieno[3,2-d]pyrazole |
| PubChem CID | 130319733 |
| Molecular Formula | C6H5IN2S |
| Molecular Weight | 264.09 g/mol |
| Exact Mass | 263.92 |
| IUPAC Name | 1-iodo-3-methylthieno[3,2-d]pyrazole |
| SMILES | Cc1nn(I)c2sccc12 |
| InChI | InChI=1S/C6H5IN2S/c1-4-5-2-3-10-6(5)9(7)8-4/h2-3H,1H3 |
| InChIKey | VIBDISZYWVIYGE-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.09 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-iodo-3-methylthieno[3,2-d]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodo-3-methylthieno[3,2-d]pyrazole?
The IUPAC name of 1-iodo-3-methylthieno[3,2-d]pyrazole (CID 130319733) is 1-iodo-3-methylthieno[3,2-d]pyrazole.
What is the SMILES notation for 1-iodo-3-methylthieno[3,2-d]pyrazole?
The canonical SMILES for 1-iodo-3-methylthieno[3,2-d]pyrazole is Cc1nn(I)c2sccc12.
What is the InChIKey of 1-iodo-3-methylthieno[3,2-d]pyrazole?
The InChIKey is VIBDISZYWVIYGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5IN2S/c1-4-5-2-3-10-6(5)9(7)8-4/h2-3H,1H3.
What are the key properties of 1-iodo-3-methylthieno[3,2-d]pyrazole?
1-iodo-3-methylthieno[3,2-d]pyrazole has a molecular weight of 264.09 g/mol, XLogP of 2.60, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodo-3-methylthieno[3,2-d]pyrazole is sourced from PubChem (CID 130319733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).