C12H23N3 — CID 130320073
(4E,6E)-2,5,6-trimethyl-7-(2-methylhydrazinyl)octa-2,4,6-trien-3-amine (PubChem CID 130320073) has the molecular formula C12H23N3 and a molecular weight of 209.34 g/mol. Its IUPAC name is (4E,6E)-2,5,6-trimethyl-7-(2-methylhydrazinyl)octa-2,4,6-trien-3-amine.
| Compound Name | (4E,6E)-2,5,6-trimethyl-7-(2-methylhydrazinyl)octa-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 130320073 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | (4E,6E)-2,5,6-trimethyl-7-(2-methylhydrazinyl)octa-2,4,6-trien-3-amine |
| SMILES | CNN/C(C)=C(C)/C(C)=C/C(N)=C(C)C |
| InChI | InChI=1S/C12H23N3/c1-8(2)12(13)7-9(3)10(4)11(5)15-14-6/h7,14-15H,13H2,1-6H3/b9-7+,11-10+ |
| InChIKey | MLOLKZUIHWEAOI-RJECPTDASA-N |
| XLogP | 2.20 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|