About propan-2-yl 2-diazenylacetate
propan-2-yl 2-diazenylacetate (PubChem CID 130320226) has the molecular formula C5H10N2O2
and a molecular weight of 130.15 g/mol. Its IUPAC name is propan-2-yl 2-diazenylacetate.
Molecular Properties
| Compound Name | propan-2-yl 2-diazenylacetate |
| PubChem CID | 130320226 |
| Molecular Formula | C5H10N2O2 |
| Molecular Weight | 130.15 g/mol |
| Exact Mass | 130.07 |
| IUPAC Name | propan-2-yl 2-diazenylacetate |
| SMILES | [H]/N=N/CC(=O)OC(C)C |
| InChI | InChI=1S/C5H10N2O2/c1-4(2)9-5(8)3-7-6/h4,6H,3H2,1-2H3/b7-6+ |
| InChIKey | UGOYURCQJSFURN-VOTSOKGWSA-N |
| XLogP | 0.97 |
| TPSA | 62.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.15 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl 2-diazenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-diazenylacetate?
The IUPAC name of propan-2-yl 2-diazenylacetate (CID 130320226) is propan-2-yl 2-diazenylacetate.
What is the SMILES notation for propan-2-yl 2-diazenylacetate?
The canonical SMILES for propan-2-yl 2-diazenylacetate is [H]/N=N/CC(=O)OC(C)C.
What is the InChIKey of propan-2-yl 2-diazenylacetate?
The InChIKey is UGOYURCQJSFURN-VOTSOKGWSA-N. The full InChI is InChI=1S/C5H10N2O2/c1-4(2)9-5(8)3-7-6/h4,6H,3H2,1-2H3/b7-6+.
What are the key properties of propan-2-yl 2-diazenylacetate?
propan-2-yl 2-diazenylacetate has a molecular weight of 130.15 g/mol, XLogP of 0.97, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-diazenylacetate is sourced from PubChem (CID 130320226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).