C28H29NO7S — CID 130320310
8-cyclopropyl-7-[[4-[(3S,6S)-3-hydroxy-6-(hydroxymethyl)oxan-2-yl]oxynaphthalen-1-yl]methyl]-5-oxo-2,3-dihydro-[1,3]thiazolo[3,2-a]pyridine-3-carboxylic acid (PubChem CID 130320310) has the molecular formula C28H29NO7S and a molecular weight of 523.61 g/mol. Its IUPAC name is 8-cyclopropyl-7-[[4-[(3S,6S)-3-hydroxy-6-(hydroxymethyl)oxan-2-yl]oxynaphthalen-1-yl]methyl]-5-oxo-2,3-dihydro-[1,3]thiazolo[3,2-a]pyridine-3-carboxylic acid.
| Compound Name | 8-cyclopropyl-7-[[4-[(3S,6S)-3-hydroxy-6-(hydroxymethyl)oxan-2-yl]oxynaphthalen-1-yl]methyl]-5-oxo-2,3-dihydro-[1,3]thiazolo[3,2-a]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 130320310 |
| Molecular Formula | C28H29NO7S |
| Molecular Weight | 523.61 g/mol |
| Exact Mass | 523.17 |
| IUPAC Name | 8-cyclopropyl-7-[[4-[(3S,6S)-3-hydroxy-6-(hydroxymethyl)oxan-2-yl]oxynaphthalen-1-yl]methyl]-5-oxo-2,3-dihydro-[1,3]thiazolo[3,2-a]pyridine-3-carboxylic acid |
| SMILES | O=C(O)C1CSc2c(C3CC3)c(Cc3ccc(OC4O[C@H](CO)CC[C@@H]4O)c4ccccc34)cc(=O)n21 |
| InChI | InChI=1S/C28H29NO7S/c30-13-18-8-9-22(31)28(35-18)36-23-10-7-16(19-3-1-2-4-20(19)23)11-17-12-24(32)29-21(27(33)34)14-37-26(29)25(17)15-5-6-15/h1-4,7,10,12,15,18,21-22,28,30-31H,5-6,8-9,11,13-14H2,(H,33,34)/t18-,21?,22-,28?/m0/s1 |
| InChIKey | WPZNRUBLMWKPBP-MPTSHXORSA-N |
| XLogP | 3.44 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.61 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |